C29H31ClN6O4 — CID 162426131
2-[2-[[4-[4-[2-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-1H-benzimidazol-5-yl]phenyl]phenyl]methylamino]ethyl]guanidine (PubChem CID 162426131) has the molecular formula C29H31ClN6O4 and a molecular weight of 563.06 g/mol. Its IUPAC name is 2-[2-[[4-[4-[2-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-1H-benzimidazol-5-yl]phenyl]phenyl]methylamino]ethyl]guanidine.
| Compound Name | 2-[2-[[4-[4-[2-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-1H-benzimidazol-5-yl]phenyl]phenyl]methylamino]ethyl]guanidine |
|---|---|
| PubChem CID | 162426131 |
| Molecular Formula | C29H31ClN6O4 |
| Molecular Weight | 563.06 g/mol |
| Exact Mass | 562.21 |
| IUPAC Name | 2-[2-[[4-[4-[2-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-1H-benzimidazol-5-yl]phenyl]phenyl]methylamino]ethyl]guanidine |
| SMILES | NC(N)=NCCNCc1ccc(-c2ccc(-c3cc4nc(O[C@@H]5CO[C@H]6[C@@H]5OC[C@H]6O)[nH]c4cc3Cl)cc2)cc1 |
| InChI | InChI=1S/C29H31ClN6O4/c30-21-12-23-22(35-29(36-23)40-25-15-39-26-24(37)14-38-27(25)26)11-20(21)19-7-5-18(6-8-19)17-3-1-16(2-4-17)13-33-9-10-34-28(31)32/h1-8,11-12,24-27,33,37H,9-10,13-15H2,(H,35,36)(H4,31,32,34)/t24-,25-,26-,27-/m1/s1 |
| InChIKey | ORKUUDJJGYPXTN-FPCALVHFSA-N |
| XLogP | 2.82 |
| TPSA | 153.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.06 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|