C20H19ClF2N4O5 — CID 130391290
(3R,3aR,6R,6aR)-6-[[6-chloro-5-[(2,6-difluoro-3-methoxyphenyl)methylamino]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 130391290) has the molecular formula C20H19ClF2N4O5 and a molecular weight of 468.84 g/mol. Its IUPAC name is (3R,3aR,6R,6aR)-6-[[6-chloro-5-[(2,6-difluoro-3-methoxyphenyl)methylamino]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | (3R,3aR,6R,6aR)-6-[[6-chloro-5-[(2,6-difluoro-3-methoxyphenyl)methylamino]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 130391290 |
| Molecular Formula | C20H19ClF2N4O5 |
| Molecular Weight | 468.84 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | (3R,3aR,6R,6aR)-6-[[6-chloro-5-[(2,6-difluoro-3-methoxyphenyl)methylamino]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | COc1ccc(F)c(CNc2nc3nc(O[C@@H]4CO[C@H]5[C@@H]4OC[C@H]5O)[nH]c3cc2Cl)c1F |
| InChI | InChI=1S/C20H19ClF2N4O5/c1-29-13-3-2-10(22)8(15(13)23)5-24-18-9(21)4-11-19(26-18)27-20(25-11)32-14-7-31-16-12(28)6-30-17(14)16/h2-4,12,14,16-17,28H,5-7H2,1H3,(H2,24,25,26,27)/t12-,14-,16-,17-/m1/s1 |
| InChIKey | GEHPDASJUCJAAJ-ODVANORSSA-N |
| XLogP | 2.42 |
| TPSA | 110.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.84 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |