C22H23ClF2N4O4 — CID 145072530
2-[[(3R,6R,6aR)-6-propan-2-yloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-6-chloro-N-[(2,6-difluorophenyl)methyl]-1H-imidazo[4,5-b]pyridin-5-amine (PubChem CID 145072530) has the molecular formula C22H23ClF2N4O4 and a molecular weight of 480.90 g/mol. Its IUPAC name is 2-[[(3R,6R,6aR)-6-propan-2-yloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-6-chloro-N-[(2,6-difluorophenyl)methyl]-1H-imidazo[4,5-b]pyridin-5-amine.
| Compound Name | 2-[[(3R,6R,6aR)-6-propan-2-yloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-6-chloro-N-[(2,6-difluorophenyl)methyl]-1H-imidazo[4,5-b]pyridin-5-amine |
|---|---|
| PubChem CID | 145072530 |
| Molecular Formula | C22H23ClF2N4O4 |
| Molecular Weight | 480.90 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | 2-[[(3R,6R,6aR)-6-propan-2-yloxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-6-chloro-N-[(2,6-difluorophenyl)methyl]-1H-imidazo[4,5-b]pyridin-5-amine |
| SMILES | CC(C)O[C@@H]1COC2[C@H](Oc3nc4nc(NCc5c(F)cccc5F)c(Cl)cc4[nH]3)CO[C@@H]21 |
| InChI | InChI=1S/C22H23ClF2N4O4/c1-10(2)32-16-8-30-19-17(9-31-18(16)19)33-22-27-15-6-12(23)20(28-21(15)29-22)26-7-11-13(24)4-3-5-14(11)25/h3-6,10,16-19H,7-9H2,1-2H3,(H2,26,27,28,29)/t16-,17-,18-,19?/m1/s1 |
| InChIKey | UTSUVTOAZDXUJH-SLZIBOOSSA-N |
| XLogP | 3.84 |
| TPSA | 90.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.90 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |