C20H25ClN6O5 — CID 130391657
(3R,3aR,6R,6aR)-6-[[6-chloro-5-[[1-(3-methoxypropyl)pyrazol-3-yl]methylamino]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 130391657) has the molecular formula C20H25ClN6O5 and a molecular weight of 464.91 g/mol. Its IUPAC name is (3R,3aR,6R,6aR)-6-[[6-chloro-5-[[1-(3-methoxypropyl)pyrazol-3-yl]methylamino]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | (3R,3aR,6R,6aR)-6-[[6-chloro-5-[[1-(3-methoxypropyl)pyrazol-3-yl]methylamino]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 130391657 |
| Molecular Formula | C20H25ClN6O5 |
| Molecular Weight | 464.91 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | (3R,3aR,6R,6aR)-6-[[6-chloro-5-[[1-(3-methoxypropyl)pyrazol-3-yl]methylamino]-1H-imidazo[4,5-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | COCCCn1ccc(CNc2nc3nc(O[C@@H]4CO[C@H]5[C@@H]4OC[C@H]5O)[nH]c3cc2Cl)n1 |
| InChI | InChI=1S/C20H25ClN6O5/c1-29-6-2-4-27-5-3-11(26-27)8-22-18-12(21)7-13-19(24-18)25-20(23-13)32-15-10-31-16-14(28)9-30-17(15)16/h3,5,7,14-17,28H,2,4,6,8-10H2,1H3,(H2,22,23,24,25)/t14-,15-,16-,17-/m1/s1 |
| InChIKey | NFYVIDLYIDXDKQ-QBPKDAKJSA-N |
| XLogP | 1.36 |
| TPSA | 128.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.91 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|