C9H8N4O2 — CID 144691311
4-(6-methylpyrazin-2-yl)-1H-pyrazole-5-carboxylic acid (PubChem CID 144691311) has the molecular formula C9H8N4O2 and a molecular weight of 204.19 g/mol. Its IUPAC name is 4-(6-methylpyrazin-2-yl)-1H-pyrazole-5-carboxylic acid.
| Compound Name | 4-(6-methylpyrazin-2-yl)-1H-pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 144691311 |
| Molecular Formula | C9H8N4O2 |
| Molecular Weight | 204.19 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | 4-(6-methylpyrazin-2-yl)-1H-pyrazole-5-carboxylic acid |
| SMILES | Cc1cncc(-c2cn[nH]c2C(=O)O)n1 |
| InChI | InChI=1S/C9H8N4O2/c1-5-2-10-4-7(12-5)6-3-11-13-8(6)9(14)15/h2-4H,1H3,(H,11,13)(H,14,15) |
| InChIKey | KMOZVTCMLKYWQG-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.19 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |