C11H12N4O2 — CID 144691403
amino 4-(4,6-dimethyl-2-pyridinyl)-1H-pyrazole-5-carboxylate (PubChem CID 144691403) has the molecular formula C11H12N4O2 and a molecular weight of 232.24 g/mol. Its IUPAC name is amino 4-(4,6-dimethyl-2-pyridinyl)-1H-pyrazole-5-carboxylate.
| Compound Name | amino 4-(4,6-dimethyl-2-pyridinyl)-1H-pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 144691403 |
| Molecular Formula | C11H12N4O2 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | amino 4-(4,6-dimethyl-2-pyridinyl)-1H-pyrazole-5-carboxylate |
| SMILES | Cc1cc(C)nc(-c2cn[nH]c2C(=O)ON)c1 |
| InChI | InChI=1S/C11H12N4O2/c1-6-3-7(2)14-9(4-6)8-5-13-15-10(8)11(16)17-12/h3-5H,12H2,1-2H3,(H,13,15) |
| InChIKey | NONOZBSZVHIPCL-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|