C21H19F2N7O2S — CID 144691469
4-[4-(difluoromethyl)-1,3-thiazol-2-yl]-N-[2-(2-methoxyphenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-7-yl]-1H-pyrazole-5-carboxamide (PubChem CID 144691469) has the molecular formula C21H19F2N7O2S and a molecular weight of 471.49 g/mol. Its IUPAC name is 4-[4-(difluoromethyl)-1,3-thiazol-2-yl]-N-[2-(2-methoxyphenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-7-yl]-1H-pyrazole-5-carboxamide.
| Compound Name | 4-[4-(difluoromethyl)-1,3-thiazol-2-yl]-N-[2-(2-methoxyphenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-7-yl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 144691469 |
| Molecular Formula | C21H19F2N7O2S |
| Molecular Weight | 471.49 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | 4-[4-(difluoromethyl)-1,3-thiazol-2-yl]-N-[2-(2-methoxyphenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-7-yl]-1H-pyrazole-5-carboxamide |
| SMILES | COc1ccccc1-c1nc2n(n1)CCC(NC(=O)c1[nH]ncc1-c1nc(C(F)F)cs1)C2 |
| InChI | InChI=1S/C21H19F2N7O2S/c1-32-15-5-3-2-4-12(15)19-27-16-8-11(6-7-30(16)29-19)25-20(31)17-13(9-24-28-17)21-26-14(10-33-21)18(22)23/h2-5,9-11,18H,6-8H2,1H3,(H,24,28)(H,25,31) |
| InChIKey | UXVYPSKXRPLSHE-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 110.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.49 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |