C21H35N — CID 144691723
2-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene;8-methyl-4a,5,6,7,8,8a-hexahydroisoquinoline (PubChem CID 144691723) has the molecular formula C21H35N and a molecular weight of 301.52 g/mol. Its IUPAC name is 2-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene;8-methyl-4a,5,6,7,8,8a-hexahydroisoquinoline.
| Compound Name | 2-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene;8-methyl-4a,5,6,7,8,8a-hexahydroisoquinoline |
|---|---|
| PubChem CID | 144691723 |
| Molecular Formula | C21H35N |
| Molecular Weight | 301.52 g/mol |
| Exact Mass | 301.28 |
| IUPAC Name | 2-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene;8-methyl-4a,5,6,7,8,8a-hexahydroisoquinoline |
| SMILES | CC1CCC2CCCCC2C1.CC1CCCC2C=CN=CC12 |
| InChI | InChI=1S/C11H20.C10H15N/c1-9-6-7-10-4-2-3-5-11(10)8-9;1-8-3-2-4-9-5-6-11-7-10(8)9/h9-11H,2-8H2,1H3;5-10H,2-4H2,1H3 |
| InChIKey | NOPQGHNBBHMQGS-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.52 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |