C11H21NO — CID 144694237
3-[(3E)-penta-1,3-dien-3-yl]oxy-N-propan-2-ylpropan-1-amine (PubChem CID 144694237) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is 3-[(3E)-penta-1,3-dien-3-yl]oxy-N-propan-2-ylpropan-1-amine.
| Compound Name | 3-[(3E)-penta-1,3-dien-3-yl]oxy-N-propan-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 144694237 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | 3-[(3E)-penta-1,3-dien-3-yl]oxy-N-propan-2-ylpropan-1-amine |
| SMILES | C=C/C(=C\C)OCCCNC(C)C |
| InChI | InChI=1S/C11H21NO/c1-5-11(6-2)13-9-7-8-12-10(3)4/h5-6,10,12H,1,7-9H2,2-4H3/b11-6+ |
| InChIKey | QYSOLMMISJZHIA-IZZDOVSWSA-N |
| XLogP | 2.48 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|