C16H19N7O — CID 144695340
1-N-[3-(4-methoxyphenyl)triazolo[4,5-d]pyrimidin-5-yl]pent-4-ene-1,4-diamine (PubChem CID 144695340) has the molecular formula C16H19N7O and a molecular weight of 325.38 g/mol. Its IUPAC name is 1-N-[3-(4-methoxyphenyl)triazolo[4,5-d]pyrimidin-5-yl]pent-4-ene-1,4-diamine.
| Compound Name | 1-N-[3-(4-methoxyphenyl)triazolo[4,5-d]pyrimidin-5-yl]pent-4-ene-1,4-diamine |
|---|---|
| PubChem CID | 144695340 |
| Molecular Formula | C16H19N7O |
| Molecular Weight | 325.38 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | 1-N-[3-(4-methoxyphenyl)triazolo[4,5-d]pyrimidin-5-yl]pent-4-ene-1,4-diamine |
| SMILES | C=C(N)CCCNc1ncc2nnn(-c3ccc(OC)cc3)c2n1 |
| InChI | InChI=1S/C16H19N7O/c1-11(17)4-3-9-18-16-19-10-14-15(20-16)23(22-21-14)12-5-7-13(24-2)8-6-12/h5-8,10H,1,3-4,9,17H2,2H3,(H,18,19,20) |
| InChIKey | SBGIXZRQJWLLKB-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 103.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.38 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|