C19H20N8O2 — CID 90390367
3-[4-(2-methoxyethoxy)phenyl]-N-[(5-methylpyrazin-2-yl)methyl]triazolo[4,5-d]pyrimidin-5-amine (PubChem CID 90390367) has the molecular formula C19H20N8O2 and a molecular weight of 392.42 g/mol. Its IUPAC name is 3-[4-(2-methoxyethoxy)phenyl]-N-[(5-methylpyrazin-2-yl)methyl]triazolo[4,5-d]pyrimidin-5-amine.
| Compound Name | 3-[4-(2-methoxyethoxy)phenyl]-N-[(5-methylpyrazin-2-yl)methyl]triazolo[4,5-d]pyrimidin-5-amine |
|---|---|
| PubChem CID | 90390367 |
| Molecular Formula | C19H20N8O2 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 3-[4-(2-methoxyethoxy)phenyl]-N-[(5-methylpyrazin-2-yl)methyl]triazolo[4,5-d]pyrimidin-5-amine |
| SMILES | COCCOc1ccc(-n2nnc3cnc(NCc4cnc(C)cn4)nc32)cc1 |
| InChI | InChI=1S/C19H20N8O2/c1-13-9-21-14(10-20-13)11-22-19-23-12-17-18(24-19)27(26-25-17)15-3-5-16(6-4-15)29-8-7-28-2/h3-6,9-10,12H,7-8,11H2,1-2H3,(H,22,23,24) |
| InChIKey | WRPFFULJQGONMB-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|