C11H10ClN4O2- — CID 144695477
2-chloro-4-N-(4-methoxyphenyl)-5-N-oxidopyrimidine-4,5-diamine (PubChem CID 144695477) has the molecular formula C11H10ClN4O2- and a molecular weight of 265.68 g/mol. Its IUPAC name is 2-chloro-4-N-(4-methoxyphenyl)-5-N-oxidopyrimidine-4,5-diamine.
| Compound Name | 2-chloro-4-N-(4-methoxyphenyl)-5-N-oxidopyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 144695477 |
| Molecular Formula | C11H10ClN4O2- |
| Molecular Weight | 265.68 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | 2-chloro-4-N-(4-methoxyphenyl)-5-N-oxidopyrimidine-4,5-diamine |
| SMILES | COc1ccc(Nc2nc(Cl)ncc2N[O-])cc1 |
| InChI | InChI=1S/C11H10ClN4O2/c1-18-8-4-2-7(3-5-8)14-10-9(16-17)6-13-11(12)15-10/h2-6,16H,1H3,(H,13,14,15)/q-1 |
| InChIKey | YYGRHLRENACJPY-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 82.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.68 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|