C23H20N4O5 — CID 144695994
1-[2-[4-(1,3-benzodioxol-5-yloxy)phenyl]-6-formylpyrimidin-4-yl]pyrrolidine-2-carboxamide (PubChem CID 144695994) has the molecular formula C23H20N4O5 and a molecular weight of 432.44 g/mol. Its IUPAC name is 1-[2-[4-(1,3-benzodioxol-5-yloxy)phenyl]-6-formylpyrimidin-4-yl]pyrrolidine-2-carboxamide.
| Compound Name | 1-[2-[4-(1,3-benzodioxol-5-yloxy)phenyl]-6-formylpyrimidin-4-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 144695994 |
| Molecular Formula | C23H20N4O5 |
| Molecular Weight | 432.44 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 1-[2-[4-(1,3-benzodioxol-5-yloxy)phenyl]-6-formylpyrimidin-4-yl]pyrrolidine-2-carboxamide |
| SMILES | NC(=O)C1CCCN1c1cc(C=O)nc(-c2ccc(Oc3ccc4c(c3)OCO4)cc2)n1 |
| InChI | InChI=1S/C23H20N4O5/c24-22(29)18-2-1-9-27(18)21-10-15(12-28)25-23(26-21)14-3-5-16(6-4-14)32-17-7-8-19-20(11-17)31-13-30-19/h3-8,10-12,18H,1-2,9,13H2,(H2,24,29) |
| InChIKey | ATWSFMUTRXVZKK-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 116.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.44 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|