C35H31BrN4O — CID 144697514
4-(5-bromo-1-tritylindazol-3-yl)-N-(2-methoxyethyl)-N-methylpyridin-2-amine (PubChem CID 144697514) has the molecular formula C35H31BrN4O and a molecular weight of 603.56 g/mol. Its IUPAC name is 4-(5-bromo-1-tritylindazol-3-yl)-N-(2-methoxyethyl)-N-methylpyridin-2-amine.
| Compound Name | 4-(5-bromo-1-tritylindazol-3-yl)-N-(2-methoxyethyl)-N-methylpyridin-2-amine |
|---|---|
| PubChem CID | 144697514 |
| Molecular Formula | C35H31BrN4O |
| Molecular Weight | 603.56 g/mol |
| Exact Mass | 602.17 |
| IUPAC Name | 4-(5-bromo-1-tritylindazol-3-yl)-N-(2-methoxyethyl)-N-methylpyridin-2-amine |
| SMILES | COCCN(C)c1cc(-c2nn(C(c3ccccc3)(c3ccccc3)c3ccccc3)c3ccc(Br)cc23)ccn1 |
| InChI | InChI=1S/C35H31BrN4O/c1-39(22-23-41-2)33-24-26(20-21-37-33)34-31-25-30(36)18-19-32(31)40(38-34)35(27-12-6-3-7-13-27,28-14-8-4-9-15-28)29-16-10-5-11-17-29/h3-21,24-25H,22-23H2,1-2H3 |
| InChIKey | YGWHMYQZFYTQSY-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.56 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|