C27H52 — CID 144698140
1-tert-butyl-3-ethyl-5-(2,3,3,5,5,6,6-heptamethyloct-7-en-2-yl)cyclohexane (PubChem CID 144698140) has the molecular formula C27H52 and a molecular weight of 376.71 g/mol. Its IUPAC name is 1-tert-butyl-3-ethyl-5-(2,3,3,5,5,6,6-heptamethyloct-7-en-2-yl)cyclohexane.
| Compound Name | 1-tert-butyl-3-ethyl-5-(2,3,3,5,5,6,6-heptamethyloct-7-en-2-yl)cyclohexane |
|---|---|
| PubChem CID | 144698140 |
| Molecular Formula | C27H52 |
| Molecular Weight | 376.71 g/mol |
| Exact Mass | 376.41 |
| IUPAC Name | 1-tert-butyl-3-ethyl-5-(2,3,3,5,5,6,6-heptamethyloct-7-en-2-yl)cyclohexane |
| SMILES | C=CC(C)(C)C(C)(C)CC(C)(C)C(C)(C)C1CC(CC)CC(C(C)(C)C)C1 |
| InChI | InChI=1S/C27H52/c1-14-20-16-21(23(3,4)5)18-22(17-20)27(12,13)26(10,11)19-25(8,9)24(6,7)15-2/h15,20-22H,2,14,16-19H2,1,3-13H3 |
| InChIKey | YGZQOWANBOBUAP-UHFFFAOYSA-N |
| XLogP | 9.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.71 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|