C31H62 — CID 144698144
1,3-ditert-butyl-5-(2,3,3,5,5,6,6,7-octamethylnonan-2-yl)cyclohexane (PubChem CID 144698144) has the molecular formula C31H62 and a molecular weight of 434.84 g/mol. Its IUPAC name is 1,3-ditert-butyl-5-(2,3,3,5,5,6,6,7-octamethylnonan-2-yl)cyclohexane.
| Compound Name | 1,3-ditert-butyl-5-(2,3,3,5,5,6,6,7-octamethylnonan-2-yl)cyclohexane |
|---|---|
| PubChem CID | 144698144 |
| Molecular Formula | C31H62 |
| Molecular Weight | 434.84 g/mol |
| Exact Mass | 434.49 |
| IUPAC Name | 1,3-ditert-butyl-5-(2,3,3,5,5,6,6,7-octamethylnonan-2-yl)cyclohexane |
| SMILES | CCC(C)C(C)(C)C(C)(C)CC(C)(C)C(C)(C)C1CC(C(C)(C)C)CC(C(C)(C)C)C1 |
| InChI | InChI=1S/C31H62/c1-17-22(2)30(13,14)28(9,10)21-29(11,12)31(15,16)25-19-23(26(3,4)5)18-24(20-25)27(6,7)8/h22-25H,17-21H2,1-16H3 |
| InChIKey | VAXRDJSCRUXJLI-UHFFFAOYSA-N |
| XLogP | 10.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.84 |
| LogP ≤ 5 | 10.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |