About (3,3-diethyl-2,4-dimethylhexan-2-yl)cyclopentane
(3,3-diethyl-2,4-dimethylhexan-2-yl)cyclopentane (PubChem CID 163612675) has the molecular formula C17H34
and a molecular weight of 238.46 g/mol. Its IUPAC name is (3,3-diethyl-2,4-dimethylhexan-2-yl)cyclopentane.
Molecular Properties
| Compound Name | (3,3-diethyl-2,4-dimethylhexan-2-yl)cyclopentane |
| PubChem CID | 163612675 |
| Molecular Formula | C17H34 |
| Molecular Weight | 238.46 g/mol |
| Exact Mass | 238.27 |
| IUPAC Name | (3,3-diethyl-2,4-dimethylhexan-2-yl)cyclopentane |
| SMILES | CCC(C)C(CC)(CC)C(C)(C)C1CCCC1 |
| InChI | InChI=1S/C17H34/c1-7-14(4)17(8-2,9-3)16(5,6)15-12-10-11-13-15/h14-15H,7-13H2,1-6H3 |
| InChIKey | HHHDLJUBOKFIMR-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 238.46 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (3,3-diethyl-2,4-dimethylhexan-2-yl)cyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,3-diethyl-2,4-dimethylhexan-2-yl)cyclopentane?
The IUPAC name of (3,3-diethyl-2,4-dimethylhexan-2-yl)cyclopentane (CID 163612675) is (3,3-diethyl-2,4-dimethylhexan-2-yl)cyclopentane.
What is the SMILES notation for (3,3-diethyl-2,4-dimethylhexan-2-yl)cyclopentane?
The canonical SMILES for (3,3-diethyl-2,4-dimethylhexan-2-yl)cyclopentane is CCC(C)C(CC)(CC)C(C)(C)C1CCCC1.
What is the InChIKey of (3,3-diethyl-2,4-dimethylhexan-2-yl)cyclopentane?
The InChIKey is HHHDLJUBOKFIMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34/c1-7-14(4)17(8-2,9-3)16(5,6)15-12-10-11-13-15/h14-15H,7-13H2,1-6H3.
What are the key properties of (3,3-diethyl-2,4-dimethylhexan-2-yl)cyclopentane?
(3,3-diethyl-2,4-dimethylhexan-2-yl)cyclopentane has a molecular weight of 238.46 g/mol, XLogP of 6.06, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3,3-diethyl-2,4-dimethylhexan-2-yl)cyclopentane is sourced from PubChem (CID 163612675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).