C15H27NO — CID 144700167
ethane;4-[(2Z,4Z)-2-ethenylhexa-2,4-dienyl]piperidin-4-ol (PubChem CID 144700167) has the molecular formula C15H27NO and a molecular weight of 237.39 g/mol. Its IUPAC name is ethane;4-[(2Z,4Z)-2-ethenylhexa-2,4-dienyl]piperidin-4-ol.
| Compound Name | ethane;4-[(2Z,4Z)-2-ethenylhexa-2,4-dienyl]piperidin-4-ol |
|---|---|
| PubChem CID | 144700167 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | ethane;4-[(2Z,4Z)-2-ethenylhexa-2,4-dienyl]piperidin-4-ol |
| SMILES | C=C/C(=C\C=C/C)CC1(O)CCNCC1.CC |
| InChI | InChI=1S/C13H21NO.C2H6/c1-3-5-6-12(4-2)11-13(15)7-9-14-10-8-13;1-2/h3-6,14-15H,2,7-11H2,1H3;1-2H3/b5-3-,12-6+; |
| InChIKey | MPQVWNGAIPNDPB-IXKMJOFVSA-N |
| XLogP | 3.21 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|