C25H24ClNO6 — CID 144700427
6-chloro-2-[[(3R,6R)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-5-[4-[1-(hydroxymethyl)cyclopropyl]phenyl]-1H-indole-3-carbaldehyde (PubChem CID 144700427) has the molecular formula C25H24ClNO6 and a molecular weight of 469.92 g/mol. Its IUPAC name is 6-chloro-2-[[(3R,6R)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-5-[4-[1-(hydroxymethyl)cyclopropyl]phenyl]-1H-indole-3-carbaldehyde.
| Compound Name | 6-chloro-2-[[(3R,6R)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-5-[4-[1-(hydroxymethyl)cyclopropyl]phenyl]-1H-indole-3-carbaldehyde |
|---|---|
| PubChem CID | 144700427 |
| Molecular Formula | C25H24ClNO6 |
| Molecular Weight | 469.92 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | 6-chloro-2-[[(3R,6R)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-5-[4-[1-(hydroxymethyl)cyclopropyl]phenyl]-1H-indole-3-carbaldehyde |
| SMILES | O=Cc1c(O[C@@H]2COC3C2OC[C@H]3O)[nH]c2cc(Cl)c(-c3ccc(C4(CO)CC4)cc3)cc12 |
| InChI | InChI=1S/C25H24ClNO6/c26-18-8-19-16(7-15(18)13-1-3-14(4-2-13)25(12-29)5-6-25)17(9-28)24(27-19)33-21-11-32-22-20(30)10-31-23(21)22/h1-4,7-9,20-23,27,29-30H,5-6,10-12H2/t20-,21-,22?,23?/m1/s1 |
| InChIKey | GUUDBAPTLLJTLD-KBFCKHRLSA-N |
| XLogP | 3.23 |
| TPSA | 101.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.92 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|