C28H25ClN2O6 — CID 118243506
4-[4-[2-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-3-cyano-1H-indol-5-yl]phenyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 118243506) has the molecular formula C28H25ClN2O6 and a molecular weight of 520.97 g/mol. Its IUPAC name is 4-[4-[2-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-3-cyano-1H-indol-5-yl]phenyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 4-[4-[2-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-3-cyano-1H-indol-5-yl]phenyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 118243506 |
| Molecular Formula | C28H25ClN2O6 |
| Molecular Weight | 520.97 g/mol |
| Exact Mass | 520.14 |
| IUPAC Name | 4-[4-[2-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-chloro-3-cyano-1H-indol-5-yl]phenyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | N#Cc1c(O[C@@H]2CO[C@H]3[C@@H]2OC[C@H]3O)[nH]c2cc(Cl)c(-c3ccc(C4=CCC(C(=O)O)CC4)cc3)cc12 |
| InChI | InChI=1S/C28H25ClN2O6/c29-21-10-22-19(20(11-30)27(31-22)37-24-13-36-25-23(32)12-35-26(24)25)9-18(21)16-5-1-14(2-6-16)15-3-7-17(8-4-15)28(33)34/h1-3,5-6,9-10,17,23-26,31-32H,4,7-8,12-13H2,(H,33,34)/t17?,23-,24-,25-,26-/m1/s1 |
| InChIKey | NUYHUXKBLGUAOK-ULUVPRSRSA-N |
| XLogP | 4.53 |
| TPSA | 124.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.97 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |