C13H16FNO3 — CID 144701597
(2S)-2-fluoro-7-methoxy-1,3-dimethyl-3,4-dihydro-2H-quinoline-6-carboxylic acid (PubChem CID 144701597) has the molecular formula C13H16FNO3 and a molecular weight of 253.27 g/mol. Its IUPAC name is (2S)-2-fluoro-7-methoxy-1,3-dimethyl-3,4-dihydro-2H-quinoline-6-carboxylic acid.
| Compound Name | (2S)-2-fluoro-7-methoxy-1,3-dimethyl-3,4-dihydro-2H-quinoline-6-carboxylic acid |
|---|---|
| PubChem CID | 144701597 |
| Molecular Formula | C13H16FNO3 |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | (2S)-2-fluoro-7-methoxy-1,3-dimethyl-3,4-dihydro-2H-quinoline-6-carboxylic acid |
| SMILES | COc1cc2c(cc1C(=O)O)CC(C)[C@H](F)N2C |
| InChI | InChI=1S/C13H16FNO3/c1-7-4-8-5-9(13(16)17)11(18-3)6-10(8)15(2)12(7)14/h5-7,12H,4H2,1-3H3,(H,16,17)/t7?,12-/m1/s1 |
| InChIKey | NTUPDIVWQOGQNF-RKSKCOGQSA-N |
| XLogP | 2.32 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|