C24H34N4O — CID 144701643
1-[(2S,3R)-6-(4-aminopiperidin-1-yl)-2,3-dimethyl-3,4-dihydro-2H-quinolin-1-yl]ethanone;aniline (PubChem CID 144701643) has the molecular formula C24H34N4O and a molecular weight of 394.56 g/mol. Its IUPAC name is 1-[(2S,3R)-6-(4-aminopiperidin-1-yl)-2,3-dimethyl-3,4-dihydro-2H-quinolin-1-yl]ethanone;aniline.
| Compound Name | 1-[(2S,3R)-6-(4-aminopiperidin-1-yl)-2,3-dimethyl-3,4-dihydro-2H-quinolin-1-yl]ethanone;aniline |
|---|---|
| PubChem CID | 144701643 |
| Molecular Formula | C24H34N4O |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | 1-[(2S,3R)-6-(4-aminopiperidin-1-yl)-2,3-dimethyl-3,4-dihydro-2H-quinolin-1-yl]ethanone;aniline |
| SMILES | CC(=O)N1c2ccc(N3CCC(N)CC3)cc2C[C@@H](C)[C@@H]1C.Nc1ccccc1 |
| InChI | InChI=1S/C18H27N3O.C6H7N/c1-12-10-15-11-17(20-8-6-16(19)7-9-20)4-5-18(15)21(13(12)2)14(3)22;7-6-4-2-1-3-5-6/h4-5,11-13,16H,6-10,19H2,1-3H3;1-5H,7H2/t12-,13+;/m1./s1 |
| InChIKey | VDMJQOWJMJOVNT-KZCZEQIWSA-N |
| XLogP | 3.82 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|