C26H41N3O2 — CID 139325951
N-[1-[(2S,3R)-1-acetyl-2,3-dimethyl-3,4-dihydro-2H-quinolin-6-yl]piperidin-4-yl]-2-ethyl-3,3-dimethylbutanamide (PubChem CID 139325951) has the molecular formula C26H41N3O2 and a molecular weight of 427.63 g/mol. Its IUPAC name is N-[1-[(2S,3R)-1-acetyl-2,3-dimethyl-3,4-dihydro-2H-quinolin-6-yl]piperidin-4-yl]-2-ethyl-3,3-dimethylbutanamide.
| Compound Name | N-[1-[(2S,3R)-1-acetyl-2,3-dimethyl-3,4-dihydro-2H-quinolin-6-yl]piperidin-4-yl]-2-ethyl-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 139325951 |
| Molecular Formula | C26H41N3O2 |
| Molecular Weight | 427.63 g/mol |
| Exact Mass | 427.32 |
| IUPAC Name | N-[1-[(2S,3R)-1-acetyl-2,3-dimethyl-3,4-dihydro-2H-quinolin-6-yl]piperidin-4-yl]-2-ethyl-3,3-dimethylbutanamide |
| SMILES | CCC(C(=O)NC1CCN(c2ccc3c(c2)C[C@@H](C)[C@H](C)N3C(C)=O)CC1)C(C)(C)C |
| InChI | InChI=1S/C26H41N3O2/c1-8-23(26(5,6)7)25(31)27-21-11-13-28(14-12-21)22-9-10-24-20(16-22)15-17(2)18(3)29(24)19(4)30/h9-10,16-18,21,23H,8,11-15H2,1-7H3,(H,27,31)/t17-,18+,23?/m1/s1 |
| InChIKey | HFQHTGAVYZYOME-BATLZEKGSA-N |
| XLogP | 4.78 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.63 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|