C18H26N2O3 — CID 167025007
(2S,3R)-1-acetyl-N-(3-methoxypropyl)-2,3-dimethyl-3,4-dihydro-2H-quinoline-6-carboxamide (PubChem CID 167025007) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is (2S,3R)-1-acetyl-N-(3-methoxypropyl)-2,3-dimethyl-3,4-dihydro-2H-quinoline-6-carboxamide.
| Compound Name | (2S,3R)-1-acetyl-N-(3-methoxypropyl)-2,3-dimethyl-3,4-dihydro-2H-quinoline-6-carboxamide |
|---|---|
| PubChem CID | 167025007 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | (2S,3R)-1-acetyl-N-(3-methoxypropyl)-2,3-dimethyl-3,4-dihydro-2H-quinoline-6-carboxamide |
| SMILES | COCCCNC(=O)c1ccc2c(c1)C[C@@H](C)[C@H](C)N2C(C)=O |
| InChI | InChI=1S/C18H26N2O3/c1-12-10-16-11-15(18(22)19-8-5-9-23-4)6-7-17(16)20(13(12)2)14(3)21/h6-7,11-13H,5,8-10H2,1-4H3,(H,19,22)/t12-,13+/m1/s1 |
| InChIKey | LNUGFAVIAXKGKE-OLZOCXBDSA-N |
| XLogP | 2.39 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|