C23H37N3O4S — CID 46349335
N-(3-methoxypropyl)-4-(4-methylpiperidin-1-yl)-3-(4-methylpiperidin-1-yl)sulfonylbenzamide (PubChem CID 46349335) has the molecular formula C23H37N3O4S and a molecular weight of 451.63 g/mol. Its IUPAC name is N-(3-methoxypropyl)-4-(4-methylpiperidin-1-yl)-3-(4-methylpiperidin-1-yl)sulfonylbenzamide.
| Compound Name | N-(3-methoxypropyl)-4-(4-methylpiperidin-1-yl)-3-(4-methylpiperidin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 46349335 |
| Molecular Formula | C23H37N3O4S |
| Molecular Weight | 451.63 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | N-(3-methoxypropyl)-4-(4-methylpiperidin-1-yl)-3-(4-methylpiperidin-1-yl)sulfonylbenzamide |
| SMILES | COCCCNC(=O)c1ccc(N2CCC(C)CC2)c(S(=O)(=O)N2CCC(C)CC2)c1 |
| InChI | InChI=1S/C23H37N3O4S/c1-18-7-12-25(13-8-18)21-6-5-20(23(27)24-11-4-16-30-3)17-22(21)31(28,29)26-14-9-19(2)10-15-26/h5-6,17-19H,4,7-16H2,1-3H3,(H,24,27) |
| InChIKey | RZLVIKLTLRKATG-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.63 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|