C27H37N3O3S — CID 46349317
4-(4-methylpiperidin-1-yl)-3-(4-methylpiperidin-1-yl)sulfonyl-N-(1-phenylethyl)benzamide (PubChem CID 46349317) has the molecular formula C27H37N3O3S and a molecular weight of 483.68 g/mol. Its IUPAC name is 4-(4-methylpiperidin-1-yl)-3-(4-methylpiperidin-1-yl)sulfonyl-N-(1-phenylethyl)benzamide.
| Compound Name | 4-(4-methylpiperidin-1-yl)-3-(4-methylpiperidin-1-yl)sulfonyl-N-(1-phenylethyl)benzamide |
|---|---|
| PubChem CID | 46349317 |
| Molecular Formula | C27H37N3O3S |
| Molecular Weight | 483.68 g/mol |
| Exact Mass | 483.26 |
| IUPAC Name | 4-(4-methylpiperidin-1-yl)-3-(4-methylpiperidin-1-yl)sulfonyl-N-(1-phenylethyl)benzamide |
| SMILES | CC1CCN(c2ccc(C(=O)NC(C)c3ccccc3)cc2S(=O)(=O)N2CCC(C)CC2)CC1 |
| InChI | InChI=1S/C27H37N3O3S/c1-20-11-15-29(16-12-20)25-10-9-24(27(31)28-22(3)23-7-5-4-6-8-23)19-26(25)34(32,33)30-17-13-21(2)14-18-30/h4-10,19-22H,11-18H2,1-3H3,(H,28,31) |
| InChIKey | PEPFDOAPFNBBPR-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.68 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |