C25H27N3O3 — CID 50845883
4-[3-(4-methylpiperidin-1-yl)-2,5-dioxopyrrol-1-yl]-N-(1-phenylethyl)benzamide (PubChem CID 50845883) has the molecular formula C25H27N3O3 and a molecular weight of 417.51 g/mol. Its IUPAC name is 4-[3-(4-methylpiperidin-1-yl)-2,5-dioxopyrrol-1-yl]-N-(1-phenylethyl)benzamide.
| Compound Name | 4-[3-(4-methylpiperidin-1-yl)-2,5-dioxopyrrol-1-yl]-N-(1-phenylethyl)benzamide |
|---|---|
| PubChem CID | 50845883 |
| Molecular Formula | C25H27N3O3 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | 4-[3-(4-methylpiperidin-1-yl)-2,5-dioxopyrrol-1-yl]-N-(1-phenylethyl)benzamide |
| SMILES | CC1CCN(C2=CC(=O)N(c3ccc(C(=O)NC(C)c4ccccc4)cc3)C2=O)CC1 |
| InChI | InChI=1S/C25H27N3O3/c1-17-12-14-27(15-13-17)22-16-23(29)28(25(22)31)21-10-8-20(9-11-21)24(30)26-18(2)19-6-4-3-5-7-19/h3-11,16-18H,12-15H2,1-2H3,(H,26,30) |
| InChIKey | SLYRFVPMTGNGKP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|