C25H34N4O3 — CID 50846272
N-[2-(azepan-1-yl)ethyl]-4-[3-(4-methylpiperidin-1-yl)-2,5-dioxopyrrol-1-yl]benzamide (PubChem CID 50846272) has the molecular formula C25H34N4O3 and a molecular weight of 438.57 g/mol. Its IUPAC name is N-[2-(azepan-1-yl)ethyl]-4-[3-(4-methylpiperidin-1-yl)-2,5-dioxopyrrol-1-yl]benzamide.
| Compound Name | N-[2-(azepan-1-yl)ethyl]-4-[3-(4-methylpiperidin-1-yl)-2,5-dioxopyrrol-1-yl]benzamide |
|---|---|
| PubChem CID | 50846272 |
| Molecular Formula | C25H34N4O3 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | N-[2-(azepan-1-yl)ethyl]-4-[3-(4-methylpiperidin-1-yl)-2,5-dioxopyrrol-1-yl]benzamide |
| SMILES | CC1CCN(C2=CC(=O)N(c3ccc(C(=O)NCCN4CCCCCC4)cc3)C2=O)CC1 |
| InChI | InChI=1S/C25H34N4O3/c1-19-10-15-28(16-11-19)22-18-23(30)29(25(22)32)21-8-6-20(7-9-21)24(31)26-12-17-27-13-4-2-3-5-14-27/h6-9,18-19H,2-5,10-17H2,1H3,(H,26,31) |
| InChIKey | AJUGDLBOXPDDTH-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|