C25H27N3O3S — CID 50846335
4-[3-(4-methylpiperidin-1-yl)-2,5-dioxopyrrol-1-yl]-N-[(4-methylsulfanylphenyl)methyl]benzamide (PubChem CID 50846335) has the molecular formula C25H27N3O3S and a molecular weight of 449.58 g/mol. Its IUPAC name is 4-[3-(4-methylpiperidin-1-yl)-2,5-dioxopyrrol-1-yl]-N-[(4-methylsulfanylphenyl)methyl]benzamide.
| Compound Name | 4-[3-(4-methylpiperidin-1-yl)-2,5-dioxopyrrol-1-yl]-N-[(4-methylsulfanylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 50846335 |
| Molecular Formula | C25H27N3O3S |
| Molecular Weight | 449.58 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | 4-[3-(4-methylpiperidin-1-yl)-2,5-dioxopyrrol-1-yl]-N-[(4-methylsulfanylphenyl)methyl]benzamide |
| SMILES | CSc1ccc(CNC(=O)c2ccc(N3C(=O)C=C(N4CCC(C)CC4)C3=O)cc2)cc1 |
| InChI | InChI=1S/C25H27N3O3S/c1-17-11-13-27(14-12-17)22-15-23(29)28(25(22)31)20-7-5-19(6-8-20)24(30)26-16-18-3-9-21(32-2)10-4-18/h3-10,15,17H,11-14,16H2,1-2H3,(H,26,30) |
| InChIKey | GNVQULJUBPPVBJ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.58 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|