C23H30N4O3 — CID 50845783
4-(2,5-dioxo-3-piperidin-1-ylpyrrol-1-yl)-N-(3-pyrrolidin-1-ylpropyl)benzamide (PubChem CID 50845783) has the molecular formula C23H30N4O3 and a molecular weight of 410.52 g/mol. Its IUPAC name is 4-(2,5-dioxo-3-piperidin-1-ylpyrrol-1-yl)-N-(3-pyrrolidin-1-ylpropyl)benzamide.
| Compound Name | 4-(2,5-dioxo-3-piperidin-1-ylpyrrol-1-yl)-N-(3-pyrrolidin-1-ylpropyl)benzamide |
|---|---|
| PubChem CID | 50845783 |
| Molecular Formula | C23H30N4O3 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | 4-(2,5-dioxo-3-piperidin-1-ylpyrrol-1-yl)-N-(3-pyrrolidin-1-ylpropyl)benzamide |
| SMILES | O=C(NCCCN1CCCC1)c1ccc(N2C(=O)C=C(N3CCCCC3)C2=O)cc1 |
| InChI | InChI=1S/C23H30N4O3/c28-21-17-20(26-15-2-1-3-16-26)23(30)27(21)19-9-7-18(8-10-19)22(29)24-11-6-14-25-12-4-5-13-25/h7-10,17H,1-6,11-16H2,(H,24,29) |
| InChIKey | JQFIFRCBJFWUGF-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|