C18H25N3O2 — CID 144701598
(2R,3R)-2-cyclopropyl-1-ethanimidoyl-N-(2-hydroxyethyl)-3-methyl-3,4-dihydro-2H-quinoline-6-carboxamide (PubChem CID 144701598) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is (2R,3R)-2-cyclopropyl-1-ethanimidoyl-N-(2-hydroxyethyl)-3-methyl-3,4-dihydro-2H-quinoline-6-carboxamide.
| Compound Name | (2R,3R)-2-cyclopropyl-1-ethanimidoyl-N-(2-hydroxyethyl)-3-methyl-3,4-dihydro-2H-quinoline-6-carboxamide |
|---|---|
| PubChem CID | 144701598 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | (2R,3R)-2-cyclopropyl-1-ethanimidoyl-N-(2-hydroxyethyl)-3-methyl-3,4-dihydro-2H-quinoline-6-carboxamide |
| SMILES | [H]/N=C(\C)N1c2ccc(C(=O)NCCO)cc2C[C@@H](C)[C@@H]1C1CC1 |
| InChI | InChI=1S/C18H25N3O2/c1-11-9-15-10-14(18(23)20-7-8-22)5-6-16(15)21(12(2)19)17(11)13-3-4-13/h5-6,10-11,13,17,19,22H,3-4,7-9H2,1-2H3,(H,20,23)/b19-12+/t11-,17-/m1/s1 |
| InChIKey | YIENGQYMYFQERM-TZCGGTEVSA-N |
| XLogP | 2.18 |
| TPSA | 76.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|