C23H33N3O — CID 174002526
1-[(2R)-6-(1-amino-3-pentyliminoprop-1-en-2-yl)-2-cyclopropyl-3-methyl-3,4-dihydro-2H-quinolin-1-yl]ethanone (PubChem CID 174002526) has the molecular formula C23H33N3O and a molecular weight of 367.54 g/mol. Its IUPAC name is 1-[(2R)-6-(1-amino-3-pentyliminoprop-1-en-2-yl)-2-cyclopropyl-3-methyl-3,4-dihydro-2H-quinolin-1-yl]ethanone.
| Compound Name | 1-[(2R)-6-(1-amino-3-pentyliminoprop-1-en-2-yl)-2-cyclopropyl-3-methyl-3,4-dihydro-2H-quinolin-1-yl]ethanone |
|---|---|
| PubChem CID | 174002526 |
| Molecular Formula | C23H33N3O |
| Molecular Weight | 367.54 g/mol |
| Exact Mass | 367.26 |
| IUPAC Name | 1-[(2R)-6-(1-amino-3-pentyliminoprop-1-en-2-yl)-2-cyclopropyl-3-methyl-3,4-dihydro-2H-quinolin-1-yl]ethanone |
| SMILES | CCCCC/N=C/C(=CN)c1ccc2c(c1)CC(C)[C@H](C1CC1)N2C(C)=O |
| InChI | InChI=1S/C23H33N3O/c1-4-5-6-11-25-15-21(14-24)19-9-10-22-20(13-19)12-16(2)23(18-7-8-18)26(22)17(3)27/h9-10,13-16,18,23H,4-8,11-12,24H2,1-3H3/b21-14?,25-15+/t16?,23-/m1/s1 |
| InChIKey | JPEUVUJKAJPTRE-NJVBSVRZSA-N |
| XLogP | 4.57 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.54 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|