C23H30ClN3O3 — CID 144701399
acetaldehyde;5-amino-2-chlorophenol;(2R)-2-cyclopropyl-1,3-dimethyl-3,4-dihydro-2H-quinoline-6-carboxamide (PubChem CID 144701399) has the molecular formula C23H30ClN3O3 and a molecular weight of 431.96 g/mol. Its IUPAC name is acetaldehyde;5-amino-2-chlorophenol;(2R)-2-cyclopropyl-1,3-dimethyl-3,4-dihydro-2H-quinoline-6-carboxamide.
| Compound Name | acetaldehyde;5-amino-2-chlorophenol;(2R)-2-cyclopropyl-1,3-dimethyl-3,4-dihydro-2H-quinoline-6-carboxamide |
|---|---|
| PubChem CID | 144701399 |
| Molecular Formula | C23H30ClN3O3 |
| Molecular Weight | 431.96 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | acetaldehyde;5-amino-2-chlorophenol;(2R)-2-cyclopropyl-1,3-dimethyl-3,4-dihydro-2H-quinoline-6-carboxamide |
| SMILES | CC1Cc2cc(C(N)=O)ccc2N(C)[C@H]1C1CC1.CC=O.Nc1ccc(Cl)c(O)c1 |
| InChI | InChI=1S/C15H20N2O.C6H6ClNO.C2H4O/c1-9-7-12-8-11(15(16)18)5-6-13(12)17(2)14(9)10-3-4-10;7-5-2-1-4(8)3-6(5)9;1-2-3/h5-6,8-10,14H,3-4,7H2,1-2H3,(H2,16,18);1-3,9H,8H2;2H,1H3/t9?,14-;;/m1../s1 |
| InChIKey | FIZLWKOSLIJCPR-IHFNBVMCSA-N |
| XLogP | 4.03 |
| TPSA | 109.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.96 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|