C19H25N2OP — CID 167025025
1-[(2R)-2-cyclopropyl-6-[(Z)-3-imino-1-methylphosphanylprop-1-en-2-yl]-3-methyl-3,4-dihydro-2H-quinolin-1-yl]ethanone (PubChem CID 167025025) has the molecular formula C19H25N2OP and a molecular weight of 328.40 g/mol. Its IUPAC name is 1-[(2R)-2-cyclopropyl-6-[(Z)-3-imino-1-methylphosphanylprop-1-en-2-yl]-3-methyl-3,4-dihydro-2H-quinolin-1-yl]ethanone.
| Compound Name | 1-[(2R)-2-cyclopropyl-6-[(Z)-3-imino-1-methylphosphanylprop-1-en-2-yl]-3-methyl-3,4-dihydro-2H-quinolin-1-yl]ethanone |
|---|---|
| PubChem CID | 167025025 |
| Molecular Formula | C19H25N2OP |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 1-[(2R)-2-cyclopropyl-6-[(Z)-3-imino-1-methylphosphanylprop-1-en-2-yl]-3-methyl-3,4-dihydro-2H-quinolin-1-yl]ethanone |
| SMILES | [H]/N=C/C(=C\PC)c1ccc2c(c1)CC(C)[C@H](C1CC1)N2C(C)=O |
| InChI | InChI=1S/C19H25N2OP/c1-12-8-16-9-15(17(10-20)11-23-3)6-7-18(16)21(13(2)22)19(12)14-4-5-14/h6-7,9-12,14,19-20,23H,4-5,8H2,1-3H3/b17-11+,20-10+/t12?,19-/m1/s1 |
| InChIKey | RBDKQHQUGWJNKC-XKJRCODZSA-N |
| XLogP | 4.31 |
| TPSA | 44.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|