C25H40N4O2 — CID 90434637
N-[1-[(2S,3R,4R)-1-acetyl-4-amino-2,3-dimethyl-3,4-dihydro-2H-quinolin-6-yl]piperidin-4-yl]-4,4-dimethylpentanamide (PubChem CID 90434637) has the molecular formula C25H40N4O2 and a molecular weight of 428.62 g/mol. Its IUPAC name is N-[1-[(2S,3R,4R)-1-acetyl-4-amino-2,3-dimethyl-3,4-dihydro-2H-quinolin-6-yl]piperidin-4-yl]-4,4-dimethylpentanamide.
| Compound Name | N-[1-[(2S,3R,4R)-1-acetyl-4-amino-2,3-dimethyl-3,4-dihydro-2H-quinolin-6-yl]piperidin-4-yl]-4,4-dimethylpentanamide |
|---|---|
| PubChem CID | 90434637 |
| Molecular Formula | C25H40N4O2 |
| Molecular Weight | 428.62 g/mol |
| Exact Mass | 428.32 |
| IUPAC Name | N-[1-[(2S,3R,4R)-1-acetyl-4-amino-2,3-dimethyl-3,4-dihydro-2H-quinolin-6-yl]piperidin-4-yl]-4,4-dimethylpentanamide |
| SMILES | CC(=O)N1c2ccc(N3CCC(NC(=O)CCC(C)(C)C)CC3)cc2[C@H](N)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C25H40N4O2/c1-16-17(2)29(18(3)30)22-8-7-20(15-21(22)24(16)26)28-13-10-19(11-14-28)27-23(31)9-12-25(4,5)6/h7-8,15-17,19,24H,9-14,26H2,1-6H3,(H,27,31)/t16-,17-,24+/m0/s1 |
| InChIKey | SIGGUPUFLRNILP-WOGXIUBCSA-N |
| XLogP | 3.99 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.62 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |