C53H48N2S — CID 144705117
ethane;2-methyl-3-(2-methyldibenzothiophen-3-yl)-9-phenylcarbazole;(Z)-2-methyl-1-phenyl-N-(1-phenylethenyl)but-2-en-1-imine (PubChem CID 144705117) has the molecular formula C53H48N2S and a molecular weight of 745.05 g/mol. Its IUPAC name is ethane;2-methyl-3-(2-methyldibenzothiophen-3-yl)-9-phenylcarbazole;(Z)-2-methyl-1-phenyl-N-(1-phenylethenyl)but-2-en-1-imine.
| Compound Name | ethane;2-methyl-3-(2-methyldibenzothiophen-3-yl)-9-phenylcarbazole;(Z)-2-methyl-1-phenyl-N-(1-phenylethenyl)but-2-en-1-imine |
|---|---|
| PubChem CID | 144705117 |
| Molecular Formula | C53H48N2S |
| Molecular Weight | 745.05 g/mol |
| Exact Mass | 744.35 |
| IUPAC Name | ethane;2-methyl-3-(2-methyldibenzothiophen-3-yl)-9-phenylcarbazole;(Z)-2-methyl-1-phenyl-N-(1-phenylethenyl)but-2-en-1-imine |
| SMILES | C=C(/N=C(C(/C)=C\C)\c1ccccc1)c1ccccc1.CC.Cc1cc2c(cc1-c1cc3c4ccccc4n(-c4ccccc4)c3cc1C)sc1ccccc12 |
| InChI | InChI=1S/C32H23NS.C19H19N.C2H6/c1-20-16-28-24-13-7-9-15-31(24)34-32(28)19-26(20)25-18-27-23-12-6-8-14-29(23)33(30(27)17-21(25)2)22-10-4-3-5-11-22;1-4-15(2)19(18-13-9-6-10-14-18)20-16(3)17-11-7-5-8-12-17;1-2/h3-19H,1-2H3;4-14H,3H2,1-2H3;1-2H3/b;15-4-,20-19-; |
| InChIKey | LCJXYIGWKUGASR-JDMAIOAFSA-N |
| XLogP | 15.57 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.05 |
| LogP ≤ 5 | 15.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|