About (2-propylphenyl) thiohypochlorite
(2-propylphenyl) thiohypochlorite (PubChem CID 144705767) has the molecular formula C9H11ClS
and a molecular weight of 186.71 g/mol. Its IUPAC name is (2-propylphenyl) thiohypochlorite.
Molecular Properties
| Compound Name | (2-propylphenyl) thiohypochlorite |
| PubChem CID | 144705767 |
| Molecular Formula | C9H11ClS |
| Molecular Weight | 186.71 g/mol |
| Exact Mass | 186.03 |
| IUPAC Name | (2-propylphenyl) thiohypochlorite |
| SMILES | CCCc1ccccc1SCl |
| InChI | InChI=1S/C9H11ClS/c1-2-5-8-6-3-4-7-9(8)11-10/h3-4,6-7H,2,5H2,1H3 |
| InChIKey | UMNPRAOQMMSULJ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.71 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2-propylphenyl) thiohypochlorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-propylphenyl) thiohypochlorite?
The IUPAC name of (2-propylphenyl) thiohypochlorite (CID 144705767) is (2-propylphenyl) thiohypochlorite.
What is the SMILES notation for (2-propylphenyl) thiohypochlorite?
The canonical SMILES for (2-propylphenyl) thiohypochlorite is CCCc1ccccc1SCl.
What is the InChIKey of (2-propylphenyl) thiohypochlorite?
The InChIKey is UMNPRAOQMMSULJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11ClS/c1-2-5-8-6-3-4-7-9(8)11-10/h3-4,6-7H,2,5H2,1H3.
What are the key properties of (2-propylphenyl) thiohypochlorite?
(2-propylphenyl) thiohypochlorite has a molecular weight of 186.71 g/mol, XLogP of 3.88, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2-propylphenyl) thiohypochlorite is sourced from PubChem (CID 144705767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).