C17H19N2S+ — CID 20720498
2,5-dimethyl-4-(2-propylphenyl)sulfanylbenzenediazonium (PubChem CID 20720498) has the molecular formula C17H19N2S+ and a molecular weight of 283.42 g/mol. Its IUPAC name is 2,5-dimethyl-4-(2-propylphenyl)sulfanylbenzenediazonium.
| Compound Name | 2,5-dimethyl-4-(2-propylphenyl)sulfanylbenzenediazonium |
|---|---|
| PubChem CID | 20720498 |
| Molecular Formula | C17H19N2S+ |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 2,5-dimethyl-4-(2-propylphenyl)sulfanylbenzenediazonium |
| SMILES | CCCc1ccccc1Sc1cc(C)c([N+]#N)cc1C |
| InChI | InChI=1S/C17H19N2S/c1-4-7-14-8-5-6-9-16(14)20-17-11-12(2)15(19-18)10-13(17)3/h5-6,8-11H,4,7H2,1-3H3/q+1 |
| InChIKey | KGPKKBHFADYXPV-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 28.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|