About 1,2,4,7-tetramethyl-4,7-diazatricyclo[4.2.1.02,8]nonane
1,2,4,7-tetramethyl-4,7-diazatricyclo[4.2.1.02,8]nonane (PubChem CID 144707873) has the molecular formula C11H20N2
and a molecular weight of 180.29 g/mol. Its IUPAC name is 1,2,4,7-tetramethyl-4,7-diazatricyclo[4.2.1.02,8]nonane.
Analyze 1,2,4,7-tetramethyl-4,7-diazatricyclo[4.2.1.02,8]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,4,7-tetramethyl-4,7-diazatricyclo[4.2.1.02,8]nonane?
The IUPAC name of 1,2,4,7-tetramethyl-4,7-diazatricyclo[4.2.1.02,8]nonane (CID 144707873) is 1,2,4,7-tetramethyl-4,7-diazatricyclo[4.2.1.02,8]nonane.
What is the SMILES notation for 1,2,4,7-tetramethyl-4,7-diazatricyclo[4.2.1.02,8]nonane?
The canonical SMILES for 1,2,4,7-tetramethyl-4,7-diazatricyclo[4.2.1.02,8]nonane is CN1CC2CC3(C)C(N2C)C3(C)C1.
What is the InChIKey of 1,2,4,7-tetramethyl-4,7-diazatricyclo[4.2.1.02,8]nonane?
The InChIKey is QSQOUTNKUCOXQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2/c1-10-5-8-6-12(3)7-11(10,2)9(10)13(8)4/h8-9H,5-7H2,1-4H3.
What are the key properties of 1,2,4,7-tetramethyl-4,7-diazatricyclo[4.2.1.02,8]nonane?
1,2,4,7-tetramethyl-4,7-diazatricyclo[4.2.1.02,8]nonane has a molecular weight of 180.29 g/mol, XLogP of 1.03, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,4,7-tetramethyl-4,7-diazatricyclo[4.2.1.02,8]nonane is sourced from PubChem (CID 144707873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).