C15H24BFO2 — CID 144708395
2-[(3E,5Z)-3-fluoro-2,5-dimethylhepta-1,3,5-trien-4-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 144708395) has the molecular formula C15H24BFO2 and a molecular weight of 266.16 g/mol. Its IUPAC name is 2-[(3E,5Z)-3-fluoro-2,5-dimethylhepta-1,3,5-trien-4-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(3E,5Z)-3-fluoro-2,5-dimethylhepta-1,3,5-trien-4-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 144708395 |
| Molecular Formula | C15H24BFO2 |
| Molecular Weight | 266.16 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | 2-[(3E,5Z)-3-fluoro-2,5-dimethylhepta-1,3,5-trien-4-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | C=C(C)/C(F)=C(B1OC(C)(C)C(C)(C)O1)/C(C)=C\C |
| InChI | InChI=1S/C15H24BFO2/c1-9-11(4)12(13(17)10(2)3)16-18-14(5,6)15(7,8)19-16/h9H,2H2,1,3-8H3/b11-9-,13-12- |
| InChIKey | FYACJLFCCKUYCV-KBMMCUQCSA-N |
| XLogP | 4.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.16 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|