C17H26ClN3O — CID 144709386
N-[[1-[(2-chlorophenyl)methyl]imidazol-2-yl]methyl]acetamide;ethane (PubChem CID 144709386) has the molecular formula C17H26ClN3O and a molecular weight of 323.87 g/mol. Its IUPAC name is N-[[1-[(2-chlorophenyl)methyl]imidazol-2-yl]methyl]acetamide;ethane.
| Compound Name | N-[[1-[(2-chlorophenyl)methyl]imidazol-2-yl]methyl]acetamide;ethane |
|---|---|
| PubChem CID | 144709386 |
| Molecular Formula | C17H26ClN3O |
| Molecular Weight | 323.87 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | N-[[1-[(2-chlorophenyl)methyl]imidazol-2-yl]methyl]acetamide;ethane |
| SMILES | CC.CC.CC(=O)NCc1nccn1Cc1ccccc1Cl |
| InChI | InChI=1S/C13H14ClN3O.2C2H6/c1-10(18)16-8-13-15-6-7-17(13)9-11-4-2-3-5-12(11)14;2*1-2/h2-7H,8-9H2,1H3,(H,16,18);2*1-2H3 |
| InChIKey | VAFMYSVGFALXHM-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.87 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |