C15H21ClN4 — CID 42818521
N-[[1-[(2-chlorophenyl)methyl]imidazol-2-yl]methyl]-N',N'-dimethylethane-1,2-diamine (PubChem CID 42818521) has the molecular formula C15H21ClN4 and a molecular weight of 292.81 g/mol. Its IUPAC name is N-[[1-[(2-chlorophenyl)methyl]imidazol-2-yl]methyl]-N',N'-dimethylethane-1,2-diamine.
| Compound Name | N-[[1-[(2-chlorophenyl)methyl]imidazol-2-yl]methyl]-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 42818521 |
| Molecular Formula | C15H21ClN4 |
| Molecular Weight | 292.81 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | N-[[1-[(2-chlorophenyl)methyl]imidazol-2-yl]methyl]-N',N'-dimethylethane-1,2-diamine |
| SMILES | CN(C)CCNCc1nccn1Cc1ccccc1Cl |
| InChI | InChI=1S/C15H21ClN4/c1-19(2)9-7-17-11-15-18-8-10-20(15)12-13-5-3-4-6-14(13)16/h3-6,8,10,17H,7,9,11-12H2,1-2H3 |
| InChIKey | CMRAUKKFHHRJAM-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.81 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|