C14H17Cl2N3 — CID 55048807
N-[[1-[(2,6-dichlorophenyl)methyl]imidazol-2-yl]methyl]propan-1-amine (PubChem CID 55048807) has the molecular formula C14H17Cl2N3 and a molecular weight of 298.22 g/mol. Its IUPAC name is N-[[1-[(2,6-dichlorophenyl)methyl]imidazol-2-yl]methyl]propan-1-amine.
| Compound Name | N-[[1-[(2,6-dichlorophenyl)methyl]imidazol-2-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 55048807 |
| Molecular Formula | C14H17Cl2N3 |
| Molecular Weight | 298.22 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | N-[[1-[(2,6-dichlorophenyl)methyl]imidazol-2-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1nccn1Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C14H17Cl2N3/c1-2-6-17-9-14-18-7-8-19(14)10-11-12(15)4-3-5-13(11)16/h3-5,7-8,17H,2,6,9-10H2,1H3 |
| InChIKey | XQQVKPGYQNLPBV-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.22 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|