C15H20Cl2N4 — CID 42818937
N-[[1-[(2,4-dichlorophenyl)methyl]imidazol-2-yl]methyl]-N',N'-dimethylethane-1,2-diamine (PubChem CID 42818937) has the molecular formula C15H20Cl2N4 and a molecular weight of 327.26 g/mol. Its IUPAC name is N-[[1-[(2,4-dichlorophenyl)methyl]imidazol-2-yl]methyl]-N',N'-dimethylethane-1,2-diamine.
| Compound Name | N-[[1-[(2,4-dichlorophenyl)methyl]imidazol-2-yl]methyl]-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 42818937 |
| Molecular Formula | C15H20Cl2N4 |
| Molecular Weight | 327.26 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | N-[[1-[(2,4-dichlorophenyl)methyl]imidazol-2-yl]methyl]-N',N'-dimethylethane-1,2-diamine |
| SMILES | CN(C)CCNCc1nccn1Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H20Cl2N4/c1-20(2)7-5-18-10-15-19-6-8-21(15)11-12-3-4-13(16)9-14(12)17/h3-4,6,8-9,18H,5,7,10-11H2,1-2H3 |
| InChIKey | BLVJPOTYFQBEBK-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.26 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|