C22H35NO3 — CID 144709697
azetidin-2-one;(2-cyclohexylphenyl)methyl butanoate;ethane (PubChem CID 144709697) has the molecular formula C22H35NO3 and a molecular weight of 361.53 g/mol. Its IUPAC name is azetidin-2-one;(2-cyclohexylphenyl)methyl butanoate;ethane.
| Compound Name | azetidin-2-one;(2-cyclohexylphenyl)methyl butanoate;ethane |
|---|---|
| PubChem CID | 144709697 |
| Molecular Formula | C22H35NO3 |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.26 |
| IUPAC Name | azetidin-2-one;(2-cyclohexylphenyl)methyl butanoate;ethane |
| SMILES | CC.CCCC(=O)OCc1ccccc1C1CCCCC1.O=C1CCN1 |
| InChI | InChI=1S/C17H24O2.C3H5NO.C2H6/c1-2-8-17(18)19-13-15-11-6-7-12-16(15)14-9-4-3-5-10-14;5-3-1-2-4-3;1-2/h6-7,11-12,14H,2-5,8-10,13H2,1H3;1-2H2,(H,4,5);1-2H3 |
| InChIKey | UXRLLFOKLVOHJV-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |