C19H28O3 — CID 144709960
6-[(2-butan-2-ylcyclohexyl)methoxy]-2-hydroxy-3-methylbenzaldehyde (PubChem CID 144709960) has the molecular formula C19H28O3 and a molecular weight of 304.43 g/mol. Its IUPAC name is 6-[(2-butan-2-ylcyclohexyl)methoxy]-2-hydroxy-3-methylbenzaldehyde.
| Compound Name | 6-[(2-butan-2-ylcyclohexyl)methoxy]-2-hydroxy-3-methylbenzaldehyde |
|---|---|
| PubChem CID | 144709960 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | 6-[(2-butan-2-ylcyclohexyl)methoxy]-2-hydroxy-3-methylbenzaldehyde |
| SMILES | CCC(C)C1CCCCC1COc1ccc(C)c(O)c1C=O |
| InChI | InChI=1S/C19H28O3/c1-4-13(2)16-8-6-5-7-15(16)12-22-18-10-9-14(3)19(21)17(18)11-20/h9-11,13,15-16,21H,4-8,12H2,1-3H3 |
| InChIKey | FADYTZBRUXSRRO-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|