C20H30O4 — CID 86274823
2-hydroxy-6-[[2-(2-hydroxypentan-2-yl)cyclohexyl]methoxy]-3-methylbenzaldehyde (PubChem CID 86274823) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is 2-hydroxy-6-[[2-(2-hydroxypentan-2-yl)cyclohexyl]methoxy]-3-methylbenzaldehyde.
| Compound Name | 2-hydroxy-6-[[2-(2-hydroxypentan-2-yl)cyclohexyl]methoxy]-3-methylbenzaldehyde |
|---|---|
| PubChem CID | 86274823 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | 2-hydroxy-6-[[2-(2-hydroxypentan-2-yl)cyclohexyl]methoxy]-3-methylbenzaldehyde |
| SMILES | CCCC(C)(O)C1CCCCC1COc1ccc(C)c(O)c1C=O |
| InChI | InChI=1S/C20H30O4/c1-4-11-20(3,23)17-8-6-5-7-15(17)13-24-18-10-9-14(2)19(22)16(18)12-21/h9-10,12,15,17,22-23H,4-8,11,13H2,1-3H3 |
| InChIKey | XKZOVPQOYHFLNO-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|