C17H23ClO4 — CID 86275548
3-chloro-2-hydroxy-6-[[2-(2-hydroxypropan-2-yl)cyclohexyl]methoxy]benzaldehyde (PubChem CID 86275548) has the molecular formula C17H23ClO4 and a molecular weight of 326.82 g/mol. Its IUPAC name is 3-chloro-2-hydroxy-6-[[2-(2-hydroxypropan-2-yl)cyclohexyl]methoxy]benzaldehyde.
| Compound Name | 3-chloro-2-hydroxy-6-[[2-(2-hydroxypropan-2-yl)cyclohexyl]methoxy]benzaldehyde |
|---|---|
| PubChem CID | 86275548 |
| Molecular Formula | C17H23ClO4 |
| Molecular Weight | 326.82 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 3-chloro-2-hydroxy-6-[[2-(2-hydroxypropan-2-yl)cyclohexyl]methoxy]benzaldehyde |
| SMILES | CC(C)(O)C1CCCCC1COc1ccc(Cl)c(O)c1C=O |
| InChI | InChI=1S/C17H23ClO4/c1-17(2,21)13-6-4-3-5-11(13)10-22-15-8-7-14(18)16(20)12(15)9-19/h7-9,11,13,20-21H,3-6,10H2,1-2H3 |
| InChIKey | SOIARPRAMNWQQX-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.82 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|