C19H19ClF2N2O3 — CID 90427242
3-chloro-6-[[2-[2-(2,2-difluoroethyl)pyrazol-3-yl]cyclohexen-1-yl]methoxy]-2-hydroxybenzaldehyde (PubChem CID 90427242) has the molecular formula C19H19ClF2N2O3 and a molecular weight of 396.82 g/mol. Its IUPAC name is 3-chloro-6-[[2-[2-(2,2-difluoroethyl)pyrazol-3-yl]cyclohexen-1-yl]methoxy]-2-hydroxybenzaldehyde.
| Compound Name | 3-chloro-6-[[2-[2-(2,2-difluoroethyl)pyrazol-3-yl]cyclohexen-1-yl]methoxy]-2-hydroxybenzaldehyde |
|---|---|
| PubChem CID | 90427242 |
| Molecular Formula | C19H19ClF2N2O3 |
| Molecular Weight | 396.82 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | 3-chloro-6-[[2-[2-(2,2-difluoroethyl)pyrazol-3-yl]cyclohexen-1-yl]methoxy]-2-hydroxybenzaldehyde |
| SMILES | O=Cc1c(OCC2=C(c3ccnn3CC(F)F)CCCC2)ccc(Cl)c1O |
| InChI | InChI=1S/C19H19ClF2N2O3/c20-15-5-6-17(14(10-25)19(15)26)27-11-12-3-1-2-4-13(12)16-7-8-23-24(16)9-18(21)22/h5-8,10,18,26H,1-4,9,11H2 |
| InChIKey | AQDAVEABZGHNPX-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.82 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|