C20H21F3N2O3 — CID 90434196
2-hydroxy-6-[[2-[2-(3,3,3-trifluoropropyl)pyrazol-3-yl]cyclohexen-1-yl]methoxy]benzaldehyde (PubChem CID 90434196) has the molecular formula C20H21F3N2O3 and a molecular weight of 394.39 g/mol. Its IUPAC name is 2-hydroxy-6-[[2-[2-(3,3,3-trifluoropropyl)pyrazol-3-yl]cyclohexen-1-yl]methoxy]benzaldehyde.
| Compound Name | 2-hydroxy-6-[[2-[2-(3,3,3-trifluoropropyl)pyrazol-3-yl]cyclohexen-1-yl]methoxy]benzaldehyde |
|---|---|
| PubChem CID | 90434196 |
| Molecular Formula | C20H21F3N2O3 |
| Molecular Weight | 394.39 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 2-hydroxy-6-[[2-[2-(3,3,3-trifluoropropyl)pyrazol-3-yl]cyclohexen-1-yl]methoxy]benzaldehyde |
| SMILES | O=Cc1c(O)cccc1OCC1=C(c2ccnn2CCC(F)(F)F)CCCC1 |
| InChI | InChI=1S/C20H21F3N2O3/c21-20(22,23)9-11-25-17(8-10-24-25)15-5-2-1-4-14(15)13-28-19-7-3-6-18(27)16(19)12-26/h3,6-8,10,12,27H,1-2,4-5,9,11,13H2 |
| InChIKey | LWYNIBLPBDFOCR-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.39 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|